Cách tính hệ số polime hóa

     

Cách giải bài xích tập tính thông số polime hóa (tính số đôi mắt xích) hay, đưa ra tiết

Với biện pháp giải bài xích tập tính thông số polime hóa (tính số mắt xích) hay, cụ thể Hoá học lớp 12 có đầy đủ phương pháp giải, lấy ví dụ như minh họa và bài xích tập trắc nghiệm bao gồm lời giải cụ thể sẽ giúp học viên ôn tập, biết cách làm dạng bài tập tính thông số polime hóa (tính số đôi mắt xích) từ đó đạt điểm trên cao trong bài thi môn Hoá học tập lớp 12.

Bạn đang xem: Cách tính hệ số polime hóa

*

Kiến thức nên nhớ

*Phương pháp giải

- Số đôi mắt xích = số phân tử monome = thông số polime hóa (n) = 6,02.1023 số mol đôi mắt xích

(Lưu ý: số đôi mắt xích đề xuất là số từ nhiên, nếu như lẻ đề nghị làm tròn)

- hệ số polime hóa (n) = hệ số trùng phù hợp

*

- một số loại polime (dựa vào phân tử khối) và số lượng polime (dựa vào team chức)

- các loại polime thường xuyên gặp:

Tên gọiCông thứcPhân tử khối (M)
Poli vinylclorua (PVC)(-CH2–CHCl-)n62,5n
Poli etilen (PE)(-CH2–CH2-)n28n
Cao su thiên nhiên<-CH2–C(CH3)=CH-CH2->n68n
Cao su clopren(-CH2-CCl=CH-CH2-)n88,5n
Cao su buna(-CH2-CH=CH-CH2-)n54n
Poli propilen (PP)<-CH2-CH(CH3)->n42n

Ví dụ minh họa

Ví dụ 1: Phân tử khối mức độ vừa phải của polietilen X là 420000. Thông số polime hoá của PE là:

Hướng dẫn giải

PE là (CH2-CH2)n bao gồm M = 420000 = 28n

⇒ n = 15.000 (hệ số polime hóa)

Ví dụ 2: Clo hoá PVC chiếm được một polime cất 63,96% clo về khối lượng, mức độ vừa phải 1 phân tử clo bội phản ứng với k mắt xích trong mạch PVC. Giá trị của k là ?

Hướng dẫn giải

Mắt xích PVC là C2H3Cl ⇒ k đôi mắt xích trong mạch PVC bao gồm công thức là C2kH3kClk

C2kH3kClk + Cl2 → C2kH3k-1Clk+1 + HCl

⇒ %Cl =

*
= 63,96%

⇒ k = 3

Ví dụ 3: Một polime X được khẳng định có phân tử khối là 39026,5 đvC với thông số trùng vừa lòng để làm cho polime này là 625. Polime X là?

Hướng dẫn giải

Polime bao gồm Mmắt xích =

*
= 62,5 ⇒ dấu hiệu của nguyên tố clo.

Gọi công thức X là CxHyCl ⇒ 12x + y = 27

⇒ X có công thức là C2H3Cl ⇔ CH2=CHCl

Bài tập vận dụng

Bài 1: cân nặng của một đoạn nilon – 6,6 là 27346 đvC với một đoạn mạch tơ capron là 17176 đvC. Số lượng mắt xích trong khúc mạch của 2 polime nêu trên lần lượt là?

A. 113 với 152B. 121 và 114C. 121 với 152D. 113 với 114

Lời giải:

Đáp án: C

M--n = 27346 đvC

→ 226n = 27346 → n = 121.

M--n= 17176 đvC

→ 113n = 17176 → n = 152.

Xem thêm: 10 Loài Hoa Gì Chỉ Nở Buổi Đêm Ý Nghĩa Nhất? Top 10 Loài Hoa Nở Về Đêm

Bài 2: một đoạn tơ nilon – 6,6 có khối lượng 7,5g thì số mắt xích trong đoạn tơ kia là?

A. 0,133.1022B. 1,99. 1022 C. 1,6. 1015D. 2,5. 1016

Lời giải:

Đáp án: B

Tơ nilon-6,6: <-HN-(CH2)6-NH-OC-(CH2)4-CO->n

→ Số mắt xích: n = (7,5/226).6,023.1023

→ n = 1,99.1022

Bài 3: hệ số trùng phù hợp của poli(etylen) là bao nhiêu nếu vừa đủ một phân tử polime có cân nặng khoảng 120 000 đvC ?

A. 4280B. 4286C. 4281D. 4627

Lời giải:

Đáp án: B

Polime: (C2H4)n có M = 120000 = 28n → n = 4286

Bài 4: Tính cân nặng trung bình của một phân tử cao su poli isopren, biết số mắt xích mức độ vừa phải là 700?

A. 45600B. 47653C. 47600D. 48920

Lời giải:

Đáp án: C

n = (mpolime)/(mmonome) → mpoli isopren = 700. 68 = 47600

Bài 5: Một polime có phân tử khối là 28000 đvC và hệ số polime hóa là 10000. Polime ấy là:

A. PE B. PVC C. PP D. Teflon

Lời giải:

Đáp án: A

Phân tử khối của một đôi mắt xích là 28000: 10000= 28 ( C2H5)

Vậy polime là PE (polietilen)

Bài 6: khi clo hoá PVC ta chiếm được một một số loại tơ clorin có chứa 66,7% clo về khối lượng. Hỏi trung bình một phân tử clo công dụng với bao nhiêu mắt xích PVC?

A. 4 B. 1 C. 3 D. 2

Lời giải:

Đáp án: D

PVC hay Poli (vinyl clorua) là (C2H3Cl)n tốt C2nH3nCln.

1 đôi mắt xích ứng với n = 1 ⇒ CT của 1 mắt xích: C2H3Cl.

kC2H3Cl + Cl2 → C2kH3k–1Clk+1 + HCl.

Xem thêm: Cảm Nhận Về Người Đàn Bà Hàng Chài, Trong Chiếc Thuyền Ngoài Xa

⇒ %mCl =

*
.100% = 66,7% ⇒ k ≈ 2.

⇒ trung bình 1 phân tử Cl2 tác dụng với 2 đôi mắt xích

Bài 7: Polime được trùng phù hợp từ etilen. Hỏi 280g polietilen đã được trùng vừa lòng từ tối thiểu bao nhiêu phân tử etilen?

A. 3,01.1024 B. 6,02.1024 C. 6,02.1023 D. 10

Lời giải:

Đáp án: B

Số phân tử etilen tối thiểu: (280/28). 6,2.1023 = 6,02.1024

Bài 8: Trùng hòa hợp propilen thu được polipropilen (PP). Nếu như đốt cháy toàn 1 mol polime kia thu được 13200 gam CO2. Thông số trùng hòa hợp n của polime kia là: